About 4-ethoxybenzoic acid
4-ethoxybenzoic acid (PubChem CID 12093) has the molecular formula C9H10O3
and a molecular weight of 166.18 g/mol. Its IUPAC name is 4-ethoxybenzoic acid.
Molecular Properties
| Compound Name | 4-ethoxybenzoic acid |
| PubChem CID | 12093 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 4-ethoxybenzoic acid |
| SMILES | CCOc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C9H10O3/c1-2-12-8-5-3-7(4-6-8)9(10)11/h3-6H,2H2,1H3,(H,10,11) |
| InChIKey | SHSGDXCJYVZFTP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxybenzoic acid?
The IUPAC name of 4-ethoxybenzoic acid (CID 12093) is 4-ethoxybenzoic acid.
What is the SMILES notation for 4-ethoxybenzoic acid?
The canonical SMILES for 4-ethoxybenzoic acid is CCOc1ccc(C(=O)O)cc1.
What is the InChIKey of 4-ethoxybenzoic acid?
The InChIKey is SHSGDXCJYVZFTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3/c1-2-12-8-5-3-7(4-6-8)9(10)11/h3-6H,2H2,1H3,(H,10,11).
What are the key properties of 4-ethoxybenzoic acid?
4-ethoxybenzoic acid has a molecular weight of 166.18 g/mol, XLogP of 1.78, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxybenzoic acid is sourced from PubChem (CID 12093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).