About (2R,3S)-N-(5-cycloheptyl-1H-pyrazol-3-yl)-2-methylmorpholine-3-carboxamide;hydrochloride
(2R,3S)-N-(5-cycloheptyl-1H-pyrazol-3-yl)-2-methylmorpholine-3-carboxamide;hydrochloride (PubChem CID 120933939) has the molecular formula C16H27ClN4O2
and a molecular weight of 342.87 g/mol. Its IUPAC name is (2R,3S)-N-(5-cycloheptyl-1H-pyrazol-3-yl)-2-methylmorpholine-3-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | (2R,3S)-N-(5-cycloheptyl-1H-pyrazol-3-yl)-2-methylmorpholine-3-carboxamide;hydrochloride |
| PubChem CID | 120933939 |
| Molecular Formula | C16H27ClN4O2 |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | (2R,3S)-N-(5-cycloheptyl-1H-pyrazol-3-yl)-2-methylmorpholine-3-carboxamide;hydrochloride |
| SMILES | C[C@H]1OCCN[C@@H]1C(=O)Nc1cc(C2CCCCCC2)[nH]n1.Cl |
| InChI | InChI=1S/C16H26N4O2.ClH/c1-11-15(17-8-9-22-11)16(21)18-14-10-13(19-20-14)12-6-4-2-3-5-7-12;/h10-12,15,17H,2-9H2,1H3,(H2,18,19,20,21);1H/t11-,15+;/m1./s1 |
| InChIKey | FKLHDNDXWDYCLG-BTAXJDQBSA-N |
| XLogP | 2.58 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R,3S)-N-(5-cycloheptyl-1H-pyrazol-3-yl)-2-methylmorpholine-3-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-N-(5-cycloheptyl-1H-pyrazol-3-yl)-2-methylmorpholine-3-carboxamide;hydrochloride?
The IUPAC name of (2R,3S)-N-(5-cycloheptyl-1H-pyrazol-3-yl)-2-methylmorpholine-3-carboxamide;hydrochloride (CID 120933939) is (2R,3S)-N-(5-cycloheptyl-1H-pyrazol-3-yl)-2-methylmorpholine-3-carboxamide;hydrochloride.
What is the SMILES notation for (2R,3S)-N-(5-cycloheptyl-1H-pyrazol-3-yl)-2-methylmorpholine-3-carboxamide;hydrochloride?
The canonical SMILES for (2R,3S)-N-(5-cycloheptyl-1H-pyrazol-3-yl)-2-methylmorpholine-3-carboxamide;hydrochloride is C[C@H]1OCCN[C@@H]1C(=O)Nc1cc(C2CCCCCC2)[nH]n1.Cl.
What is the InChIKey of (2R,3S)-N-(5-cycloheptyl-1H-pyrazol-3-yl)-2-methylmorpholine-3-carboxamide;hydrochloride?
The InChIKey is FKLHDNDXWDYCLG-BTAXJDQBSA-N. The full InChI is InChI=1S/C16H26N4O2.ClH/c1-11-15(17-8-9-22-11)16(21)18-14-10-13(19-20-14)12-6-4-2-3-5-7-12;/h10-12,15,17H,2-9H2,1H3,(H2,18,19,20,21);1H/t11-,15+;/m1./s1.
What are the key properties of (2R,3S)-N-(5-cycloheptyl-1H-pyrazol-3-yl)-2-methylmorpholine-3-carboxamide;hydrochloride?
(2R,3S)-N-(5-cycloheptyl-1H-pyrazol-3-yl)-2-methylmorpholine-3-carboxamide;hydrochloride has a molecular weight of 342.87 g/mol, XLogP of 2.58, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-N-(5-cycloheptyl-1H-pyrazol-3-yl)-2-methylmorpholine-3-carboxamide;hydrochloride is sourced from PubChem (CID 120933939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).