C16H27ClN4OS — CID 120934039
N-(3-methylsulfanylcyclohexyl)-4-pyrazol-1-ylpiperidine-4-carboxamide;hydrochloride (PubChem CID 120934039) has the molecular formula C16H27ClN4OS and a molecular weight of 358.94 g/mol. Its IUPAC name is N-(3-methylsulfanylcyclohexyl)-4-pyrazol-1-ylpiperidine-4-carboxamide;hydrochloride.
| Compound Name | N-(3-methylsulfanylcyclohexyl)-4-pyrazol-1-ylpiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120934039 |
| Molecular Formula | C16H27ClN4OS |
| Molecular Weight | 358.94 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | N-(3-methylsulfanylcyclohexyl)-4-pyrazol-1-ylpiperidine-4-carboxamide;hydrochloride |
| SMILES | CSC1CCCC(NC(=O)C2(n3cccn3)CCNCC2)C1.Cl |
| InChI | InChI=1S/C16H26N4OS.ClH/c1-22-14-5-2-4-13(12-14)19-15(21)16(6-9-17-10-7-16)20-11-3-8-18-20;/h3,8,11,13-14,17H,2,4-7,9-10,12H2,1H3,(H,19,21);1H |
| InChIKey | OKQCIQJHCPLQLS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.94 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |