C19H25ClN4O3 — CID 120934173
ethyl 2-[3-[(4-pyrazol-1-ylpiperidine-4-carbonyl)amino]phenyl]acetate;hydrochloride (PubChem CID 120934173) has the molecular formula C19H25ClN4O3 and a molecular weight of 392.89 g/mol. Its IUPAC name is ethyl 2-[3-[(4-pyrazol-1-ylpiperidine-4-carbonyl)amino]phenyl]acetate;hydrochloride.
| Compound Name | ethyl 2-[3-[(4-pyrazol-1-ylpiperidine-4-carbonyl)amino]phenyl]acetate;hydrochloride |
|---|---|
| PubChem CID | 120934173 |
| Molecular Formula | C19H25ClN4O3 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | ethyl 2-[3-[(4-pyrazol-1-ylpiperidine-4-carbonyl)amino]phenyl]acetate;hydrochloride |
| SMILES | CCOC(=O)Cc1cccc(NC(=O)C2(n3cccn3)CCNCC2)c1.Cl |
| InChI | InChI=1S/C19H24N4O3.ClH/c1-2-26-17(24)14-15-5-3-6-16(13-15)22-18(25)19(7-10-20-11-8-19)23-12-4-9-21-23;/h3-6,9,12-13,20H,2,7-8,10-11,14H2,1H3,(H,22,25);1H |
| InChIKey | VPUSSIGWMSBQCF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |