C17H22N4O5 — CID 120934606
[(2R,3S)-2-methylmorpholin-3-yl]-[4-(4-nitrobenzoyl)piperazin-1-yl]methanone (PubChem CID 120934606) has the molecular formula C17H22N4O5 and a molecular weight of 362.39 g/mol. Its IUPAC name is [(2R,3S)-2-methylmorpholin-3-yl]-[4-(4-nitrobenzoyl)piperazin-1-yl]methanone.
| Compound Name | [(2R,3S)-2-methylmorpholin-3-yl]-[4-(4-nitrobenzoyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 120934606 |
| Molecular Formula | C17H22N4O5 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | [(2R,3S)-2-methylmorpholin-3-yl]-[4-(4-nitrobenzoyl)piperazin-1-yl]methanone |
| SMILES | C[C@H]1OCCN[C@@H]1C(=O)N1CCN(C(=O)c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C17H22N4O5/c1-12-15(18-6-11-26-12)17(23)20-9-7-19(8-10-20)16(22)13-2-4-14(5-3-13)21(24)25/h2-5,12,15,18H,6-11H2,1H3/t12-,15+/m1/s1 |
| InChIKey | QJZQCYFFQGAXKA-DOMZBBRYSA-N |
| XLogP | 0.26 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|