C16H22N2O2 — CID 120935072
(2R,3S)-N-(2-benzylcyclopropyl)-2-methylmorpholine-3-carboxamide (PubChem CID 120935072) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is (2R,3S)-N-(2-benzylcyclopropyl)-2-methylmorpholine-3-carboxamide.
| Compound Name | (2R,3S)-N-(2-benzylcyclopropyl)-2-methylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 120935072 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | (2R,3S)-N-(2-benzylcyclopropyl)-2-methylmorpholine-3-carboxamide |
| SMILES | C[C@H]1OCCN[C@@H]1C(=O)NC1CC1Cc1ccccc1 |
| InChI | InChI=1S/C16H22N2O2/c1-11-15(17-7-8-20-11)16(19)18-14-10-13(14)9-12-5-3-2-4-6-12/h2-6,11,13-15,17H,7-10H2,1H3,(H,18,19)/t11-,13?,14?,15+/m1/s1 |
| InChIKey | KQHVWXXHYSPIRP-WPPJOMGTSA-N |
| XLogP | 1.11 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |