C15H27ClN4O3 — CID 120935148
(3R,4S)-N-[1-(2-methoxyethoxy)propan-2-yl]-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide;hydrochloride (PubChem CID 120935148) has the molecular formula C15H27ClN4O3 and a molecular weight of 346.86 g/mol. Its IUPAC name is (3R,4S)-N-[1-(2-methoxyethoxy)propan-2-yl]-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | (3R,4S)-N-[1-(2-methoxyethoxy)propan-2-yl]-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120935148 |
| Molecular Formula | C15H27ClN4O3 |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (3R,4S)-N-[1-(2-methoxyethoxy)propan-2-yl]-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide;hydrochloride |
| SMILES | COCCOCC(C)NC(=O)[C@H]1CNC[C@@H]1c1cnn(C)c1.Cl |
| InChI | InChI=1S/C15H26N4O3.ClH/c1-11(10-22-5-4-21-3)18-15(20)14-8-16-7-13(14)12-6-17-19(2)9-12;/h6,9,11,13-14,16H,4-5,7-8,10H2,1-3H3,(H,18,20);1H/t11?,13-,14+;/m1./s1 |
| InChIKey | XVAPZIGBLNRJLB-FKZJAIKDSA-N |
| XLogP | 0.31 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|