C15H26N2O2S — CID 120935565
2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl-[4-(aminomethyl)oxan-4-yl]methanone (PubChem CID 120935565) has the molecular formula C15H26N2O2S and a molecular weight of 298.45 g/mol. Its IUPAC name is 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl-[4-(aminomethyl)oxan-4-yl]methanone.
| Compound Name | 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl-[4-(aminomethyl)oxan-4-yl]methanone |
|---|---|
| PubChem CID | 120935565 |
| Molecular Formula | C15H26N2O2S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl-[4-(aminomethyl)oxan-4-yl]methanone |
| SMILES | NCC1(C(=O)N2CCSC3CCCCC32)CCOCC1 |
| InChI | InChI=1S/C15H26N2O2S/c16-11-15(5-8-19-9-6-15)14(18)17-7-10-20-13-4-2-1-3-12(13)17/h12-13H,1-11,16H2 |
| InChIKey | KWRNIDNKVLUNKV-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |