C17H20F2N4O2 — CID 120935836
N-[4-(2,2-difluoroethoxy)phenyl]-4-pyrazol-1-ylpiperidine-4-carboxamide (PubChem CID 120935836) has the molecular formula C17H20F2N4O2 and a molecular weight of 350.37 g/mol. Its IUPAC name is N-[4-(2,2-difluoroethoxy)phenyl]-4-pyrazol-1-ylpiperidine-4-carboxamide.
| Compound Name | N-[4-(2,2-difluoroethoxy)phenyl]-4-pyrazol-1-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 120935836 |
| Molecular Formula | C17H20F2N4O2 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | N-[4-(2,2-difluoroethoxy)phenyl]-4-pyrazol-1-ylpiperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(OCC(F)F)cc1)C1(n2cccn2)CCNCC1 |
| InChI | InChI=1S/C17H20F2N4O2/c18-15(19)12-25-14-4-2-13(3-5-14)22-16(24)17(6-9-20-10-7-17)23-11-1-8-21-23/h1-5,8,11,15,20H,6-7,9-10,12H2,(H,22,24) |
| InChIKey | GTYGRQXSNXRLRE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |