C19H32N4O2 — CID 120936244
(3R,4S)-N-[[1-(2-ethoxyethyl)cyclopentyl]methyl]-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide (PubChem CID 120936244) has the molecular formula C19H32N4O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is (3R,4S)-N-[[1-(2-ethoxyethyl)cyclopentyl]methyl]-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide.
| Compound Name | (3R,4S)-N-[[1-(2-ethoxyethyl)cyclopentyl]methyl]-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 120936244 |
| Molecular Formula | C19H32N4O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | (3R,4S)-N-[[1-(2-ethoxyethyl)cyclopentyl]methyl]-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide |
| SMILES | CCOCCC1(CNC(=O)[C@H]2CNC[C@@H]2c2cnn(C)c2)CCCC1 |
| InChI | InChI=1S/C19H32N4O2/c1-3-25-9-8-19(6-4-5-7-19)14-21-18(24)17-12-20-11-16(17)15-10-22-23(2)13-15/h10,13,16-17,20H,3-9,11-12,14H2,1-2H3,(H,21,24)/t16-,17+/m1/s1 |
| InChIKey | UHPSCEUIUIMVTG-SJORKVTESA-N |
| XLogP | 1.83 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|