C16H26N4O2 — CID 120936377
(3R,4S)-N-[2-(cyclopropylmethoxy)ethyl]-N-methyl-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide (PubChem CID 120936377) has the molecular formula C16H26N4O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is (3R,4S)-N-[2-(cyclopropylmethoxy)ethyl]-N-methyl-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide.
| Compound Name | (3R,4S)-N-[2-(cyclopropylmethoxy)ethyl]-N-methyl-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 120936377 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | (3R,4S)-N-[2-(cyclopropylmethoxy)ethyl]-N-methyl-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide |
| SMILES | CN(CCOCC1CC1)C(=O)[C@H]1CNC[C@@H]1c1cnn(C)c1 |
| InChI | InChI=1S/C16H26N4O2/c1-19(5-6-22-11-12-3-4-12)16(21)15-9-17-8-14(15)13-7-18-20(2)10-13/h7,10,12,14-15,17H,3-6,8-9,11H2,1-2H3/t14-,15+/m1/s1 |
| InChIKey | LZFQFHDMNRRALZ-CABCVRRESA-N |
| XLogP | 0.61 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|