C17H29N5O2 — CID 120941305
[4-(2-hydroxypropyl)-3-methylpiperazin-1-yl]-(4-pyrazol-1-ylpiperidin-4-yl)methanone (PubChem CID 120941305) has the molecular formula C17H29N5O2 and a molecular weight of 335.45 g/mol. Its IUPAC name is [4-(2-hydroxypropyl)-3-methylpiperazin-1-yl]-(4-pyrazol-1-ylpiperidin-4-yl)methanone.
| Compound Name | [4-(2-hydroxypropyl)-3-methylpiperazin-1-yl]-(4-pyrazol-1-ylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 120941305 |
| Molecular Formula | C17H29N5O2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | [4-(2-hydroxypropyl)-3-methylpiperazin-1-yl]-(4-pyrazol-1-ylpiperidin-4-yl)methanone |
| SMILES | CC(O)CN1CCN(C(=O)C2(n3cccn3)CCNCC2)CC1C |
| InChI | InChI=1S/C17H29N5O2/c1-14-12-21(11-10-20(14)13-15(2)23)16(24)17(4-7-18-8-5-17)22-9-3-6-19-22/h3,6,9,14-15,18,23H,4-5,7-8,10-13H2,1-2H3 |
| InChIKey | MIQULWUIXHNOPJ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |