About (2R,3S)-N,2-dimethyl-N-(2-pyrazol-1-ylethyl)morpholine-3-carboxamide
(2R,3S)-N,2-dimethyl-N-(2-pyrazol-1-ylethyl)morpholine-3-carboxamide (PubChem CID 120941752) has the molecular formula C12H20N4O2
and a molecular weight of 252.32 g/mol. Its IUPAC name is (2R,3S)-N,2-dimethyl-N-(2-pyrazol-1-ylethyl)morpholine-3-carboxamide.
Molecular Properties
| Compound Name | (2R,3S)-N,2-dimethyl-N-(2-pyrazol-1-ylethyl)morpholine-3-carboxamide |
| PubChem CID | 120941752 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | (2R,3S)-N,2-dimethyl-N-(2-pyrazol-1-ylethyl)morpholine-3-carboxamide |
| SMILES | C[C@H]1OCCN[C@@H]1C(=O)N(C)CCn1cccn1 |
| InChI | InChI=1S/C12H20N4O2/c1-10-11(13-5-9-18-10)12(17)15(2)7-8-16-6-3-4-14-16/h3-4,6,10-11,13H,5,7-9H2,1-2H3/t10-,11+/m1/s1 |
| InChIKey | CSQUMAMBXGGUFE-MNOVXSKESA-N |
| XLogP | -0.28 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R,3S)-N,2-dimethyl-N-(2-pyrazol-1-ylethyl)morpholine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-N,2-dimethyl-N-(2-pyrazol-1-ylethyl)morpholine-3-carboxamide?
The IUPAC name of (2R,3S)-N,2-dimethyl-N-(2-pyrazol-1-ylethyl)morpholine-3-carboxamide (CID 120941752) is (2R,3S)-N,2-dimethyl-N-(2-pyrazol-1-ylethyl)morpholine-3-carboxamide.
What is the SMILES notation for (2R,3S)-N,2-dimethyl-N-(2-pyrazol-1-ylethyl)morpholine-3-carboxamide?
The canonical SMILES for (2R,3S)-N,2-dimethyl-N-(2-pyrazol-1-ylethyl)morpholine-3-carboxamide is C[C@H]1OCCN[C@@H]1C(=O)N(C)CCn1cccn1.
What is the InChIKey of (2R,3S)-N,2-dimethyl-N-(2-pyrazol-1-ylethyl)morpholine-3-carboxamide?
The InChIKey is CSQUMAMBXGGUFE-MNOVXSKESA-N. The full InChI is InChI=1S/C12H20N4O2/c1-10-11(13-5-9-18-10)12(17)15(2)7-8-16-6-3-4-14-16/h3-4,6,10-11,13H,5,7-9H2,1-2H3/t10-,11+/m1/s1.
What are the key properties of (2R,3S)-N,2-dimethyl-N-(2-pyrazol-1-ylethyl)morpholine-3-carboxamide?
(2R,3S)-N,2-dimethyl-N-(2-pyrazol-1-ylethyl)morpholine-3-carboxamide has a molecular weight of 252.32 g/mol, XLogP of -0.28, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-N,2-dimethyl-N-(2-pyrazol-1-ylethyl)morpholine-3-carboxamide is sourced from PubChem (CID 120941752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).