C16H20BrN3O3 — CID 120943924
1-(3-bromophenyl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 120943924) has the molecular formula C16H20BrN3O3 and a molecular weight of 382.26 g/mol. Its IUPAC name is 1-(3-bromophenyl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(3-bromophenyl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 120943924 |
| Molecular Formula | C16H20BrN3O3 |
| Molecular Weight | 382.26 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 1-(3-bromophenyl)-N-[(4-hydroxypyrrolidin-3-yl)methyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(NCC1CNCC1O)C1CC(=O)N(c2cccc(Br)c2)C1 |
| InChI | InChI=1S/C16H20BrN3O3/c17-12-2-1-3-13(5-12)20-9-10(4-15(20)22)16(23)19-7-11-6-18-8-14(11)21/h1-3,5,10-11,14,18,21H,4,6-9H2,(H,19,23) |
| InChIKey | SQTJQCVSEQVIIY-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.26 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |