C14H17N5O2 — CID 120945565
N-[(4-hydroxypyrrolidin-3-yl)methyl]-1-pyridin-3-ylpyrazole-4-carboxamide (PubChem CID 120945565) has the molecular formula C14H17N5O2 and a molecular weight of 287.32 g/mol. Its IUPAC name is N-[(4-hydroxypyrrolidin-3-yl)methyl]-1-pyridin-3-ylpyrazole-4-carboxamide.
| Compound Name | N-[(4-hydroxypyrrolidin-3-yl)methyl]-1-pyridin-3-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 120945565 |
| Molecular Formula | C14H17N5O2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | N-[(4-hydroxypyrrolidin-3-yl)methyl]-1-pyridin-3-ylpyrazole-4-carboxamide |
| SMILES | O=C(NCC1CNCC1O)c1cnn(-c2cccnc2)c1 |
| InChI | InChI=1S/C14H17N5O2/c20-13-8-16-4-10(13)5-17-14(21)11-6-18-19(9-11)12-2-1-3-15-7-12/h1-3,6-7,9-10,13,16,20H,4-5,8H2,(H,17,21) |
| InChIKey | BVGGQGQPYQIORX-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |