C13H15ClN6O2 — CID 120945715
2-chloro-N-[(4-hydroxypyrrolidin-3-yl)methyl]-4-(tetrazol-1-yl)benzamide (PubChem CID 120945715) has the molecular formula C13H15ClN6O2 and a molecular weight of 322.76 g/mol. Its IUPAC name is 2-chloro-N-[(4-hydroxypyrrolidin-3-yl)methyl]-4-(tetrazol-1-yl)benzamide.
| Compound Name | 2-chloro-N-[(4-hydroxypyrrolidin-3-yl)methyl]-4-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 120945715 |
| Molecular Formula | C13H15ClN6O2 |
| Molecular Weight | 322.76 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 2-chloro-N-[(4-hydroxypyrrolidin-3-yl)methyl]-4-(tetrazol-1-yl)benzamide |
| SMILES | O=C(NCC1CNCC1O)c1ccc(-n2cnnn2)cc1Cl |
| InChI | InChI=1S/C13H15ClN6O2/c14-11-3-9(20-7-17-18-19-20)1-2-10(11)13(22)16-5-8-4-15-6-12(8)21/h1-3,7-8,12,15,21H,4-6H2,(H,16,22) |
| InChIKey | JSGNJYGOIFYGDI-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.76 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |