C17H19FN4O2 — CID 120946923
2-(2-fluoroanilino)-N-[(4-hydroxypyrrolidin-3-yl)methyl]pyridine-3-carboxamide (PubChem CID 120946923) has the molecular formula C17H19FN4O2 and a molecular weight of 330.36 g/mol. Its IUPAC name is 2-(2-fluoroanilino)-N-[(4-hydroxypyrrolidin-3-yl)methyl]pyridine-3-carboxamide.
| Compound Name | 2-(2-fluoroanilino)-N-[(4-hydroxypyrrolidin-3-yl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 120946923 |
| Molecular Formula | C17H19FN4O2 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 2-(2-fluoroanilino)-N-[(4-hydroxypyrrolidin-3-yl)methyl]pyridine-3-carboxamide |
| SMILES | O=C(NCC1CNCC1O)c1cccnc1Nc1ccccc1F |
| InChI | InChI=1S/C17H19FN4O2/c18-13-5-1-2-6-14(13)22-16-12(4-3-7-20-16)17(24)21-9-11-8-19-10-15(11)23/h1-7,11,15,19,23H,8-10H2,(H,20,22)(H,21,24) |
| InChIKey | FNCUFKWWGRVXOE-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |