C18H27N3O4S — CID 120948133
1-benzylsulfonyl-N-[(4-hydroxypyrrolidin-3-yl)methyl]piperidine-3-carboxamide (PubChem CID 120948133) has the molecular formula C18H27N3O4S and a molecular weight of 381.50 g/mol. Its IUPAC name is 1-benzylsulfonyl-N-[(4-hydroxypyrrolidin-3-yl)methyl]piperidine-3-carboxamide.
| Compound Name | 1-benzylsulfonyl-N-[(4-hydroxypyrrolidin-3-yl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 120948133 |
| Molecular Formula | C18H27N3O4S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 1-benzylsulfonyl-N-[(4-hydroxypyrrolidin-3-yl)methyl]piperidine-3-carboxamide |
| SMILES | O=C(NCC1CNCC1O)C1CCCN(S(=O)(=O)Cc2ccccc2)C1 |
| InChI | InChI=1S/C18H27N3O4S/c22-17-11-19-9-16(17)10-20-18(23)15-7-4-8-21(12-15)26(24,25)13-14-5-2-1-3-6-14/h1-3,5-6,15-17,19,22H,4,7-13H2,(H,20,23) |
| InChIKey | VBYUORSISXWATD-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |