About 2-[1-[[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]methyl]azepan-4-yl]acetamide
2-[1-[[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]methyl]azepan-4-yl]acetamide (PubChem CID 120949930) has the molecular formula C12H19F3N6O
and a molecular weight of 320.32 g/mol. Its IUPAC name is 2-[1-[[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]methyl]azepan-4-yl]acetamide.
Molecular Properties
| Compound Name | 2-[1-[[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]methyl]azepan-4-yl]acetamide |
| PubChem CID | 120949930 |
| Molecular Formula | C12H19F3N6O |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 2-[1-[[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]methyl]azepan-4-yl]acetamide |
| SMILES | NC(=O)CC1CCCN(Cc2nnnn2CC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H19F3N6O/c13-12(14,15)8-21-11(17-18-19-21)7-20-4-1-2-9(3-5-20)6-10(16)22/h9H,1-8H2,(H2,16,22) |
| InChIKey | IFKFAQDCRDNFGG-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[1-[[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]methyl]azepan-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]methyl]azepan-4-yl]acetamide?
The IUPAC name of 2-[1-[[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]methyl]azepan-4-yl]acetamide (CID 120949930) is 2-[1-[[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]methyl]azepan-4-yl]acetamide.
What is the SMILES notation for 2-[1-[[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]methyl]azepan-4-yl]acetamide?
The canonical SMILES for 2-[1-[[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]methyl]azepan-4-yl]acetamide is NC(=O)CC1CCCN(Cc2nnnn2CC(F)(F)F)CC1.
What is the InChIKey of 2-[1-[[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]methyl]azepan-4-yl]acetamide?
The InChIKey is IFKFAQDCRDNFGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19F3N6O/c13-12(14,15)8-21-11(17-18-19-21)7-20-4-1-2-9(3-5-20)6-10(16)22/h9H,1-8H2,(H2,16,22).
What are the key properties of 2-[1-[[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]methyl]azepan-4-yl]acetamide?
2-[1-[[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]methyl]azepan-4-yl]acetamide has a molecular weight of 320.32 g/mol, XLogP of 0.71, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[[1-(2,2,2-trifluoroethyl)tetrazol-5-yl]methyl]azepan-4-yl]acetamide is sourced from PubChem (CID 120949930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).