C14H11F6NO3 — CID 120951000
(3S,4S)-4-(trifluoromethyl)-1-[2-(2,4,5-trifluorophenyl)acetyl]pyrrolidine-3-carboxylic acid (PubChem CID 120951000) has the molecular formula C14H11F6NO3 and a molecular weight of 355.23 g/mol. Its IUPAC name is (3S,4S)-4-(trifluoromethyl)-1-[2-(2,4,5-trifluorophenyl)acetyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (3S,4S)-4-(trifluoromethyl)-1-[2-(2,4,5-trifluorophenyl)acetyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 120951000 |
| Molecular Formula | C14H11F6NO3 |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | (3S,4S)-4-(trifluoromethyl)-1-[2-(2,4,5-trifluorophenyl)acetyl]pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CN(C(=O)Cc2cc(F)c(F)cc2F)C[C@H]1C(F)(F)F |
| InChI | InChI=1S/C14H11F6NO3/c15-9-3-11(17)10(16)1-6(9)2-12(22)21-4-7(13(23)24)8(5-21)14(18,19)20/h1,3,7-8H,2,4-5H2,(H,23,24)/t7-,8-/m1/s1 |
| InChIKey | KVESTRXRIQMIRH-HTQZYQBOSA-N |
| XLogP | 2.37 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|