C14H14F3N3O6 — CID 120951375
(3S,4S)-4-(trifluoromethyl)-1-[2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetyl]pyrrolidine-3-carboxylic acid (PubChem CID 120951375) has the molecular formula C14H14F3N3O6 and a molecular weight of 377.28 g/mol. Its IUPAC name is (3S,4S)-4-(trifluoromethyl)-1-[2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (3S,4S)-4-(trifluoromethyl)-1-[2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 120951375 |
| Molecular Formula | C14H14F3N3O6 |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | (3S,4S)-4-(trifluoromethyl)-1-[2-(2,4,5-trioxo-3-prop-2-enylimidazolidin-1-yl)acetyl]pyrrolidine-3-carboxylic acid |
| SMILES | C=CCN1C(=O)C(=O)N(CC(=O)N2C[C@@H](C(F)(F)F)[C@H](C(=O)O)C2)C1=O |
| InChI | InChI=1S/C14H14F3N3O6/c1-2-3-19-10(22)11(23)20(13(19)26)6-9(21)18-4-7(12(24)25)8(5-18)14(15,16)17/h2,7-8H,1,3-6H2,(H,24,25)/t7-,8-/m1/s1 |
| InChIKey | GZACHRFWCZKKTE-HTQZYQBOSA-N |
| XLogP | -0.32 |
| TPSA | 115.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|