C14H24ClF3N2O4 — CID 120953663
(3S,4S)-1-[2-(2-butoxyethylamino)-2-oxoethyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid;hydrochloride (PubChem CID 120953663) has the molecular formula C14H24ClF3N2O4 and a molecular weight of 376.80 g/mol. Its IUPAC name is (3S,4S)-1-[2-(2-butoxyethylamino)-2-oxoethyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid;hydrochloride.
| Compound Name | (3S,4S)-1-[2-(2-butoxyethylamino)-2-oxoethyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 120953663 |
| Molecular Formula | C14H24ClF3N2O4 |
| Molecular Weight | 376.80 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | (3S,4S)-1-[2-(2-butoxyethylamino)-2-oxoethyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid;hydrochloride |
| SMILES | CCCCOCCNC(=O)CN1C[C@@H](C(F)(F)F)[C@H](C(=O)O)C1.Cl |
| InChI | InChI=1S/C14H23F3N2O4.ClH/c1-2-3-5-23-6-4-18-12(20)9-19-7-10(13(21)22)11(8-19)14(15,16)17;/h10-11H,2-9H2,1H3,(H,18,20)(H,21,22);1H/t10-,11-;/m1./s1 |
| InChIKey | NRDAJHUSLXBDBS-NDXYWBNTSA-N |
| XLogP | 1.54 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.80 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|