About (3S,4S)-1-(1-benzofuran-2-ylmethyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid;hydrochloride
(3S,4S)-1-(1-benzofuran-2-ylmethyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid;hydrochloride (PubChem CID 120954230) has the molecular formula C15H15ClF3NO3
and a molecular weight of 349.74 g/mol. Its IUPAC name is (3S,4S)-1-(1-benzofuran-2-ylmethyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | (3S,4S)-1-(1-benzofuran-2-ylmethyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid;hydrochloride |
| PubChem CID | 120954230 |
| Molecular Formula | C15H15ClF3NO3 |
| Molecular Weight | 349.74 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | (3S,4S)-1-(1-benzofuran-2-ylmethyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)[C@@H]1CN(Cc2cc3ccccc3o2)C[C@H]1C(F)(F)F |
| InChI | InChI=1S/C15H14F3NO3.ClH/c16-15(17,18)12-8-19(7-11(12)14(20)21)6-10-5-9-3-1-2-4-13(9)22-10;/h1-5,11-12H,6-8H2,(H,20,21);1H/t11-,12-;/m1./s1 |
| InChIKey | ZJZAHEHUUGHKCH-MNMPKAIFSA-N |
| XLogP | 3.55 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.74 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S,4S)-1-(1-benzofuran-2-ylmethyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-1-(1-benzofuran-2-ylmethyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid;hydrochloride?
The IUPAC name of (3S,4S)-1-(1-benzofuran-2-ylmethyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid;hydrochloride (CID 120954230) is (3S,4S)-1-(1-benzofuran-2-ylmethyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid;hydrochloride.
What is the SMILES notation for (3S,4S)-1-(1-benzofuran-2-ylmethyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid;hydrochloride?
The canonical SMILES for (3S,4S)-1-(1-benzofuran-2-ylmethyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid;hydrochloride is Cl.O=C(O)[C@@H]1CN(Cc2cc3ccccc3o2)C[C@H]1C(F)(F)F.
What is the InChIKey of (3S,4S)-1-(1-benzofuran-2-ylmethyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid;hydrochloride?
The InChIKey is ZJZAHEHUUGHKCH-MNMPKAIFSA-N. The full InChI is InChI=1S/C15H14F3NO3.ClH/c16-15(17,18)12-8-19(7-11(12)14(20)21)6-10-5-9-3-1-2-4-13(9)22-10;/h1-5,11-12H,6-8H2,(H,20,21);1H/t11-,12-;/m1./s1.
What are the key properties of (3S,4S)-1-(1-benzofuran-2-ylmethyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid;hydrochloride?
(3S,4S)-1-(1-benzofuran-2-ylmethyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid;hydrochloride has a molecular weight of 349.74 g/mol, XLogP of 3.55, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-1-(1-benzofuran-2-ylmethyl)-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid;hydrochloride is sourced from PubChem (CID 120954230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).