About ethyl 1-[2-[(4,4-difluoropyrrolidine-2-carbonyl)-methylamino]acetyl]piperidine-4-carboxylate
ethyl 1-[2-[(4,4-difluoropyrrolidine-2-carbonyl)-methylamino]acetyl]piperidine-4-carboxylate (PubChem CID 120954765) has the molecular formula C16H25F2N3O4
and a molecular weight of 361.39 g/mol. Its IUPAC name is ethyl 1-[2-[(4,4-difluoropyrrolidine-2-carbonyl)-methylamino]acetyl]piperidine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[2-[(4,4-difluoropyrrolidine-2-carbonyl)-methylamino]acetyl]piperidine-4-carboxylate |
| PubChem CID | 120954765 |
| Molecular Formula | C16H25F2N3O4 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | ethyl 1-[2-[(4,4-difluoropyrrolidine-2-carbonyl)-methylamino]acetyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)CN(C)C(=O)C2CC(F)(F)CN2)CC1 |
| InChI | InChI=1S/C16H25F2N3O4/c1-3-25-15(24)11-4-6-21(7-5-11)13(22)9-20(2)14(23)12-8-16(17,18)10-19-12/h11-12,19H,3-10H2,1-2H3 |
| InChIKey | KRXOMNZIGKABLZ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 1-[2-[(4,4-difluoropyrrolidine-2-carbonyl)-methylamino]acetyl]piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[2-[(4,4-difluoropyrrolidine-2-carbonyl)-methylamino]acetyl]piperidine-4-carboxylate?
The IUPAC name of ethyl 1-[2-[(4,4-difluoropyrrolidine-2-carbonyl)-methylamino]acetyl]piperidine-4-carboxylate (CID 120954765) is ethyl 1-[2-[(4,4-difluoropyrrolidine-2-carbonyl)-methylamino]acetyl]piperidine-4-carboxylate.
What is the SMILES notation for ethyl 1-[2-[(4,4-difluoropyrrolidine-2-carbonyl)-methylamino]acetyl]piperidine-4-carboxylate?
The canonical SMILES for ethyl 1-[2-[(4,4-difluoropyrrolidine-2-carbonyl)-methylamino]acetyl]piperidine-4-carboxylate is CCOC(=O)C1CCN(C(=O)CN(C)C(=O)C2CC(F)(F)CN2)CC1.
What is the InChIKey of ethyl 1-[2-[(4,4-difluoropyrrolidine-2-carbonyl)-methylamino]acetyl]piperidine-4-carboxylate?
The InChIKey is KRXOMNZIGKABLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25F2N3O4/c1-3-25-15(24)11-4-6-21(7-5-11)13(22)9-20(2)14(23)12-8-16(17,18)10-19-12/h11-12,19H,3-10H2,1-2H3.
What are the key properties of ethyl 1-[2-[(4,4-difluoropyrrolidine-2-carbonyl)-methylamino]acetyl]piperidine-4-carboxylate?
ethyl 1-[2-[(4,4-difluoropyrrolidine-2-carbonyl)-methylamino]acetyl]piperidine-4-carboxylate has a molecular weight of 361.39 g/mol, XLogP of 0.24, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[2-[(4,4-difluoropyrrolidine-2-carbonyl)-methylamino]acetyl]piperidine-4-carboxylate is sourced from PubChem (CID 120954765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).