C17H21FN4O2 — CID 120955135
2-[[(3aR,7aS)-1-(2-methoxyethyl)-2-oxo-3,3a,4,6,7,7a-hexahydroimidazo[4,5-c]pyridin-5-yl]methyl]-4-fluorobenzonitrile (PubChem CID 120955135) has the molecular formula C17H21FN4O2 and a molecular weight of 332.38 g/mol. Its IUPAC name is 2-[[(3aR,7aS)-1-(2-methoxyethyl)-2-oxo-3,3a,4,6,7,7a-hexahydroimidazo[4,5-c]pyridin-5-yl]methyl]-4-fluorobenzonitrile.
| Compound Name | 2-[[(3aR,7aS)-1-(2-methoxyethyl)-2-oxo-3,3a,4,6,7,7a-hexahydroimidazo[4,5-c]pyridin-5-yl]methyl]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 120955135 |
| Molecular Formula | C17H21FN4O2 |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 2-[[(3aR,7aS)-1-(2-methoxyethyl)-2-oxo-3,3a,4,6,7,7a-hexahydroimidazo[4,5-c]pyridin-5-yl]methyl]-4-fluorobenzonitrile |
| SMILES | COCCN1C(=O)N[C@@H]2CN(Cc3cc(F)ccc3C#N)CC[C@@H]21 |
| InChI | InChI=1S/C17H21FN4O2/c1-24-7-6-22-16-4-5-21(11-15(16)20-17(22)23)10-13-8-14(18)3-2-12(13)9-19/h2-3,8,15-16H,4-7,10-11H2,1H3,(H,20,23)/t15-,16+/m1/s1 |
| InChIKey | QNQGOABHROJCRQ-CVEARBPZSA-N |
| XLogP | 1.31 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |