About N-ethyl-4,4-difluoro-N-(2-methylsulfonylethyl)pyrrolidine-2-carboxamide
N-ethyl-4,4-difluoro-N-(2-methylsulfonylethyl)pyrrolidine-2-carboxamide (PubChem CID 120955174) has the molecular formula C10H18F2N2O3S
and a molecular weight of 284.33 g/mol. Its IUPAC name is N-ethyl-4,4-difluoro-N-(2-methylsulfonylethyl)pyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | N-ethyl-4,4-difluoro-N-(2-methylsulfonylethyl)pyrrolidine-2-carboxamide |
| PubChem CID | 120955174 |
| Molecular Formula | C10H18F2N2O3S |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | N-ethyl-4,4-difluoro-N-(2-methylsulfonylethyl)pyrrolidine-2-carboxamide |
| SMILES | CCN(CCS(C)(=O)=O)C(=O)C1CC(F)(F)CN1 |
| InChI | InChI=1S/C10H18F2N2O3S/c1-3-14(4-5-18(2,16)17)9(15)8-6-10(11,12)7-13-8/h8,13H,3-7H2,1-2H3 |
| InChIKey | VELHUUWMJQUBRT-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-ethyl-4,4-difluoro-N-(2-methylsulfonylethyl)pyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-4,4-difluoro-N-(2-methylsulfonylethyl)pyrrolidine-2-carboxamide?
The IUPAC name of N-ethyl-4,4-difluoro-N-(2-methylsulfonylethyl)pyrrolidine-2-carboxamide (CID 120955174) is N-ethyl-4,4-difluoro-N-(2-methylsulfonylethyl)pyrrolidine-2-carboxamide.
What is the SMILES notation for N-ethyl-4,4-difluoro-N-(2-methylsulfonylethyl)pyrrolidine-2-carboxamide?
The canonical SMILES for N-ethyl-4,4-difluoro-N-(2-methylsulfonylethyl)pyrrolidine-2-carboxamide is CCN(CCS(C)(=O)=O)C(=O)C1CC(F)(F)CN1.
What is the InChIKey of N-ethyl-4,4-difluoro-N-(2-methylsulfonylethyl)pyrrolidine-2-carboxamide?
The InChIKey is VELHUUWMJQUBRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F2N2O3S/c1-3-14(4-5-18(2,16)17)9(15)8-6-10(11,12)7-13-8/h8,13H,3-7H2,1-2H3.
What are the key properties of N-ethyl-4,4-difluoro-N-(2-methylsulfonylethyl)pyrrolidine-2-carboxamide?
N-ethyl-4,4-difluoro-N-(2-methylsulfonylethyl)pyrrolidine-2-carboxamide has a molecular weight of 284.33 g/mol, XLogP of -0.12, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-4,4-difluoro-N-(2-methylsulfonylethyl)pyrrolidine-2-carboxamide is sourced from PubChem (CID 120955174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).