C14H15N5OS — CID 120955600
5-(4-pyrazol-1-ylpiperidin-4-yl)-3-thiophen-2-yl-1,2,4-oxadiazole (PubChem CID 120955600) has the molecular formula C14H15N5OS and a molecular weight of 301.38 g/mol. Its IUPAC name is 5-(4-pyrazol-1-ylpiperidin-4-yl)-3-thiophen-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-(4-pyrazol-1-ylpiperidin-4-yl)-3-thiophen-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 120955600 |
| Molecular Formula | C14H15N5OS |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 5-(4-pyrazol-1-ylpiperidin-4-yl)-3-thiophen-2-yl-1,2,4-oxadiazole |
| SMILES | c1csc(-c2noc(C3(n4cccn4)CCNCC3)n2)c1 |
| InChI | InChI=1S/C14H15N5OS/c1-3-11(21-10-1)12-17-13(20-18-12)14(4-7-15-8-5-14)19-9-2-6-16-19/h1-3,6,9-10,15H,4-5,7-8H2 |
| InChIKey | AOFUNURAPAGWIV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |