C15H20N4O2 — CID 120957648
5-(2-ethoxyphenyl)-3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazole (PubChem CID 120957648) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 5-(2-ethoxyphenyl)-3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazole.
| Compound Name | 5-(2-ethoxyphenyl)-3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 120957648 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 5-(2-ethoxyphenyl)-3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazole |
| SMILES | CCOc1ccccc1-c1nc(C2CNCCN2C)no1 |
| InChI | InChI=1S/C15H20N4O2/c1-3-20-13-7-5-4-6-11(13)15-17-14(18-21-15)12-10-16-8-9-19(12)2/h4-7,12,16H,3,8-10H2,1-2H3 |
| InChIKey | JLAANJSSTWALDA-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 63.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |