C14H17IN4O — CID 120958607
5-(2-iodo-5-methylphenyl)-3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazole (PubChem CID 120958607) has the molecular formula C14H17IN4O and a molecular weight of 384.22 g/mol. Its IUPAC name is 5-(2-iodo-5-methylphenyl)-3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazole.
| Compound Name | 5-(2-iodo-5-methylphenyl)-3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 120958607 |
| Molecular Formula | C14H17IN4O |
| Molecular Weight | 384.22 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 5-(2-iodo-5-methylphenyl)-3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazole |
| SMILES | Cc1ccc(I)c(-c2nc(C3CNCCN3C)no2)c1 |
| InChI | InChI=1S/C14H17IN4O/c1-9-3-4-11(15)10(7-9)14-17-13(18-20-14)12-8-16-5-6-19(12)2/h3-4,7,12,16H,5-6,8H2,1-2H3 |
| InChIKey | VHLYCORLOLZNDV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.22 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|