C11H21ClN4O2 — CID 120960102
5-(2-ethoxyethyl)-3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazole;hydrochloride (PubChem CID 120960102) has the molecular formula C11H21ClN4O2 and a molecular weight of 276.77 g/mol. Its IUPAC name is 5-(2-ethoxyethyl)-3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazole;hydrochloride.
| Compound Name | 5-(2-ethoxyethyl)-3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazole;hydrochloride |
|---|---|
| PubChem CID | 120960102 |
| Molecular Formula | C11H21ClN4O2 |
| Molecular Weight | 276.77 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 5-(2-ethoxyethyl)-3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazole;hydrochloride |
| SMILES | CCOCCc1nc(C2CNCCN2C)no1.Cl |
| InChI | InChI=1S/C11H20N4O2.ClH/c1-3-16-7-4-10-13-11(14-17-10)9-8-12-5-6-15(9)2;/h9,12H,3-8H2,1-2H3;1H |
| InChIKey | ZUILUJJCZKWQPW-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 63.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.77 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|