C16H24ClN5O4S — CID 120960268
N-(2-methoxyethyl)-4-[3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazol-5-yl]benzenesulfonamide;hydrochloride (PubChem CID 120960268) has the molecular formula C16H24ClN5O4S and a molecular weight of 417.92 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-[3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazol-5-yl]benzenesulfonamide;hydrochloride.
| Compound Name | N-(2-methoxyethyl)-4-[3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazol-5-yl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120960268 |
| Molecular Formula | C16H24ClN5O4S |
| Molecular Weight | 417.92 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | N-(2-methoxyethyl)-4-[3-(1-methylpiperazin-2-yl)-1,2,4-oxadiazol-5-yl]benzenesulfonamide;hydrochloride |
| SMILES | COCCNS(=O)(=O)c1ccc(-c2nc(C3CNCCN3C)no2)cc1.Cl |
| InChI | InChI=1S/C16H23N5O4S.ClH/c1-21-9-7-17-11-14(21)15-19-16(25-20-15)12-3-5-13(6-4-12)26(22,23)18-8-10-24-2;/h3-6,14,17-18H,7-11H2,1-2H3;1H |
| InChIKey | JGHIAGSDUWDIOY-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 109.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.92 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|