About methyl 4-[(4-hydroxypyrrolidin-3-yl)methylamino]-2,2-dimethylbutanoate;hydrochloride
methyl 4-[(4-hydroxypyrrolidin-3-yl)methylamino]-2,2-dimethylbutanoate;hydrochloride (PubChem CID 120961810) has the molecular formula C12H25ClN2O3
and a molecular weight of 280.80 g/mol. Its IUPAC name is methyl 4-[(4-hydroxypyrrolidin-3-yl)methylamino]-2,2-dimethylbutanoate;hydrochloride.
Molecular Properties
| Compound Name | methyl 4-[(4-hydroxypyrrolidin-3-yl)methylamino]-2,2-dimethylbutanoate;hydrochloride |
| PubChem CID | 120961810 |
| Molecular Formula | C12H25ClN2O3 |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | methyl 4-[(4-hydroxypyrrolidin-3-yl)methylamino]-2,2-dimethylbutanoate;hydrochloride |
| SMILES | COC(=O)C(C)(C)CCNCC1CNCC1O.Cl |
| InChI | InChI=1S/C12H24N2O3.ClH/c1-12(2,11(16)17-3)4-5-13-6-9-7-14-8-10(9)15;/h9-10,13-15H,4-8H2,1-3H3;1H |
| InChIKey | XGGMAZCDMKMJDE-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[(4-hydroxypyrrolidin-3-yl)methylamino]-2,2-dimethylbutanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(4-hydroxypyrrolidin-3-yl)methylamino]-2,2-dimethylbutanoate;hydrochloride?
The IUPAC name of methyl 4-[(4-hydroxypyrrolidin-3-yl)methylamino]-2,2-dimethylbutanoate;hydrochloride (CID 120961810) is methyl 4-[(4-hydroxypyrrolidin-3-yl)methylamino]-2,2-dimethylbutanoate;hydrochloride.
What is the SMILES notation for methyl 4-[(4-hydroxypyrrolidin-3-yl)methylamino]-2,2-dimethylbutanoate;hydrochloride?
The canonical SMILES for methyl 4-[(4-hydroxypyrrolidin-3-yl)methylamino]-2,2-dimethylbutanoate;hydrochloride is COC(=O)C(C)(C)CCNCC1CNCC1O.Cl.
What is the InChIKey of methyl 4-[(4-hydroxypyrrolidin-3-yl)methylamino]-2,2-dimethylbutanoate;hydrochloride?
The InChIKey is XGGMAZCDMKMJDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O3.ClH/c1-12(2,11(16)17-3)4-5-13-6-9-7-14-8-10(9)15;/h9-10,13-15H,4-8H2,1-3H3;1H.
What are the key properties of methyl 4-[(4-hydroxypyrrolidin-3-yl)methylamino]-2,2-dimethylbutanoate;hydrochloride?
methyl 4-[(4-hydroxypyrrolidin-3-yl)methylamino]-2,2-dimethylbutanoate;hydrochloride has a molecular weight of 280.80 g/mol, XLogP of 0.17, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(4-hydroxypyrrolidin-3-yl)methylamino]-2,2-dimethylbutanoate;hydrochloride is sourced from PubChem (CID 120961810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).