C15H19Cl2N3O — CID 120962086
4-[[(6-chloroquinolin-8-yl)methylamino]methyl]pyrrolidin-3-ol;hydrochloride (PubChem CID 120962086) has the molecular formula C15H19Cl2N3O and a molecular weight of 328.24 g/mol. Its IUPAC name is 4-[[(6-chloroquinolin-8-yl)methylamino]methyl]pyrrolidin-3-ol;hydrochloride.
| Compound Name | 4-[[(6-chloroquinolin-8-yl)methylamino]methyl]pyrrolidin-3-ol;hydrochloride |
|---|---|
| PubChem CID | 120962086 |
| Molecular Formula | C15H19Cl2N3O |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 4-[[(6-chloroquinolin-8-yl)methylamino]methyl]pyrrolidin-3-ol;hydrochloride |
| SMILES | Cl.OC1CNCC1CNCc1cc(Cl)cc2cccnc12 |
| InChI | InChI=1S/C15H18ClN3O.ClH/c16-13-4-10-2-1-3-19-15(10)11(5-13)6-17-7-12-8-18-9-14(12)20;/h1-5,12,14,17-18,20H,6-9H2;1H |
| InChIKey | VYMIQXPLSMPCBL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |