C14H21ClN2O — CID 120962585
4-[[2-(3-chlorophenyl)propylamino]methyl]pyrrolidin-3-ol (PubChem CID 120962585) has the molecular formula C14H21ClN2O and a molecular weight of 268.79 g/mol. Its IUPAC name is 4-[[2-(3-chlorophenyl)propylamino]methyl]pyrrolidin-3-ol.
| Compound Name | 4-[[2-(3-chlorophenyl)propylamino]methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 120962585 |
| Molecular Formula | C14H21ClN2O |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 4-[[2-(3-chlorophenyl)propylamino]methyl]pyrrolidin-3-ol |
| SMILES | CC(CNCC1CNCC1O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H21ClN2O/c1-10(11-3-2-4-13(15)5-11)6-16-7-12-8-17-9-14(12)18/h2-5,10,12,14,16-18H,6-9H2,1H3 |
| InChIKey | LMLZMUSNHMREBI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |