C16H24FN5O2 — CID 120963351
[(2S,4R)-4-fluoro-1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)pyrrolidin-2-yl]-morpholin-4-ylmethanone (PubChem CID 120963351) has the molecular formula C16H24FN5O2 and a molecular weight of 337.40 g/mol. Its IUPAC name is [(2S,4R)-4-fluoro-1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)pyrrolidin-2-yl]-morpholin-4-ylmethanone.
| Compound Name | [(2S,4R)-4-fluoro-1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)pyrrolidin-2-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 120963351 |
| Molecular Formula | C16H24FN5O2 |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | [(2S,4R)-4-fluoro-1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)pyrrolidin-2-yl]-morpholin-4-ylmethanone |
| SMILES | O=C([C@@H]1C[C@@H](F)CN1Cc1nnc2n1CCCC2)N1CCOCC1 |
| InChI | InChI=1S/C16H24FN5O2/c17-12-9-13(16(23)20-5-7-24-8-6-20)21(10-12)11-15-19-18-14-3-1-2-4-22(14)15/h12-13H,1-11H2/t12-,13+/m1/s1 |
| InChIKey | DVGVQLBPYNQZSH-OLZOCXBDSA-N |
| XLogP | 0.39 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |