C13H18N4O — CID 120963523
(3R,4S)-1-but-2-ynyl-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide (PubChem CID 120963523) has the molecular formula C13H18N4O and a molecular weight of 246.31 g/mol. Its IUPAC name is (3R,4S)-1-but-2-ynyl-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide.
| Compound Name | (3R,4S)-1-but-2-ynyl-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 120963523 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | (3R,4S)-1-but-2-ynyl-4-(1-methylpyrazol-4-yl)pyrrolidine-3-carboxamide |
| SMILES | CC#CCN1C[C@H](C(N)=O)[C@@H](c2cnn(C)c2)C1 |
| InChI | InChI=1S/C13H18N4O/c1-3-4-5-17-8-11(12(9-17)13(14)18)10-6-15-16(2)7-10/h6-7,11-12H,5,8-9H2,1-2H3,(H2,14,18)/t11-,12+/m1/s1 |
| InChIKey | WTEQRHJPCZDDSA-NEPJUHHUSA-N |
| XLogP | -0.06 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|