C17H18ClNO6S — CID 1209649
ethyl (2R)-2-[5-[(2-chloro-4,5-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate (PubChem CID 1209649) has the molecular formula C17H18ClNO6S and a molecular weight of 399.85 g/mol. Its IUPAC name is ethyl (2R)-2-[5-[(2-chloro-4,5-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | ethyl (2R)-2-[5-[(2-chloro-4,5-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 1209649 |
| Molecular Formula | C17H18ClNO6S |
| Molecular Weight | 399.85 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | ethyl (2R)-2-[5-[(2-chloro-4,5-dimethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
| SMILES | CCOC(=O)[C@@H](C)N1C(=O)SC(=Cc2cc(OC)c(OC)cc2Cl)C1=O |
| InChI | InChI=1S/C17H18ClNO6S/c1-5-25-16(21)9(2)19-15(20)14(26-17(19)22)7-10-6-12(23-3)13(24-4)8-11(10)18/h6-9H,5H2,1-4H3/t9-/m1/s1 |
| InChIKey | ZMNYYEOYZFSEIP-SECBINFHSA-N |
| XLogP | 3.35 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.85 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|