C11H12F2N2O3 — CID 120964902
(2S)-1-[5-(difluoromethoxy)-2-pyridinyl]pyrrolidine-2-carboxylic acid (PubChem CID 120964902) has the molecular formula C11H12F2N2O3 and a molecular weight of 258.22 g/mol. Its IUPAC name is (2S)-1-[5-(difluoromethoxy)-2-pyridinyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[5-(difluoromethoxy)-2-pyridinyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 120964902 |
| Molecular Formula | C11H12F2N2O3 |
| Molecular Weight | 258.22 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | (2S)-1-[5-(difluoromethoxy)-2-pyridinyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN1c1ccc(OC(F)F)cn1 |
| InChI | InChI=1S/C11H12F2N2O3/c12-11(13)18-7-3-4-9(14-6-7)15-5-1-2-8(15)10(16)17/h3-4,6,8,11H,1-2,5H2,(H,16,17)/t8-/m0/s1 |
| InChIKey | FVJRTUFFWYPOKL-QMMMGPOBSA-N |
| XLogP | 1.74 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |