C10H10BrN3O4 — CID 120965048
(2R)-1-(3-bromo-5-nitro-2-pyridinyl)pyrrolidine-2-carboxylic acid (PubChem CID 120965048) has the molecular formula C10H10BrN3O4 and a molecular weight of 316.11 g/mol. Its IUPAC name is (2R)-1-(3-bromo-5-nitro-2-pyridinyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-(3-bromo-5-nitro-2-pyridinyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 120965048 |
| Molecular Formula | C10H10BrN3O4 |
| Molecular Weight | 316.11 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | (2R)-1-(3-bromo-5-nitro-2-pyridinyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCN1c1ncc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C10H10BrN3O4/c11-7-4-6(14(17)18)5-12-9(7)13-3-1-2-8(13)10(15)16/h4-5,8H,1-3H2,(H,15,16)/t8-/m1/s1 |
| InChIKey | UKJFLZILXMEIDA-MRVPVSSYSA-N |
| XLogP | 1.81 |
| TPSA | 96.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.11 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|