C11H16N4O2 — CID 120965297
2-[[6-(cyclopropylmethylamino)pyrimidin-4-yl]-methylamino]acetic acid (PubChem CID 120965297) has the molecular formula C11H16N4O2 and a molecular weight of 236.27 g/mol. Its IUPAC name is 2-[[6-(cyclopropylmethylamino)pyrimidin-4-yl]-methylamino]acetic acid.
| Compound Name | 2-[[6-(cyclopropylmethylamino)pyrimidin-4-yl]-methylamino]acetic acid |
|---|---|
| PubChem CID | 120965297 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 2-[[6-(cyclopropylmethylamino)pyrimidin-4-yl]-methylamino]acetic acid |
| SMILES | CN(CC(=O)O)c1cc(NCC2CC2)ncn1 |
| InChI | InChI=1S/C11H16N4O2/c1-15(6-11(16)17)10-4-9(13-7-14-10)12-5-8-2-3-8/h4,7-8H,2-3,5-6H2,1H3,(H,16,17)(H,12,13,14) |
| InChIKey | VLZTYBCJNBFQID-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |