C11H20F2N2O — CID 120966585
N-cyclopropyl-N-[2-(2,2-difluoroethoxy)ethyl]pyrrolidin-3-amine (PubChem CID 120966585) has the molecular formula C11H20F2N2O and a molecular weight of 234.29 g/mol. Its IUPAC name is N-cyclopropyl-N-[2-(2,2-difluoroethoxy)ethyl]pyrrolidin-3-amine.
| Compound Name | N-cyclopropyl-N-[2-(2,2-difluoroethoxy)ethyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 120966585 |
| Molecular Formula | C11H20F2N2O |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | N-cyclopropyl-N-[2-(2,2-difluoroethoxy)ethyl]pyrrolidin-3-amine |
| SMILES | FC(F)COCCN(C1CC1)C1CCNC1 |
| InChI | InChI=1S/C11H20F2N2O/c12-11(13)8-16-6-5-15(9-1-2-9)10-3-4-14-7-10/h9-11,14H,1-8H2 |
| InChIKey | VWRCBAQTRIJNGN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|