C14H23F2N3OS — CID 120967037
2-(2,2-difluoroethoxy)-N-[(4-methyl-1,3-thiazol-5-yl)methyl]-N-(pyrrolidin-3-ylmethyl)ethanamine (PubChem CID 120967037) has the molecular formula C14H23F2N3OS and a molecular weight of 319.42 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxy)-N-[(4-methyl-1,3-thiazol-5-yl)methyl]-N-(pyrrolidin-3-ylmethyl)ethanamine.
| Compound Name | 2-(2,2-difluoroethoxy)-N-[(4-methyl-1,3-thiazol-5-yl)methyl]-N-(pyrrolidin-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 120967037 |
| Molecular Formula | C14H23F2N3OS |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 2-(2,2-difluoroethoxy)-N-[(4-methyl-1,3-thiazol-5-yl)methyl]-N-(pyrrolidin-3-ylmethyl)ethanamine |
| SMILES | Cc1ncsc1CN(CCOCC(F)F)CC1CCNC1 |
| InChI | InChI=1S/C14H23F2N3OS/c1-11-13(21-10-18-11)8-19(4-5-20-9-14(15)16)7-12-2-3-17-6-12/h10,12,14,17H,2-9H2,1H3 |
| InChIKey | RWFVYODNCHJOQD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|