About 2-[1-[2-(2,2-difluoroethoxy)ethyl]piperidin-3-yl]ethanamine
2-[1-[2-(2,2-difluoroethoxy)ethyl]piperidin-3-yl]ethanamine (PubChem CID 120967195) has the molecular formula C11H22F2N2O
and a molecular weight of 236.31 g/mol. Its IUPAC name is 2-[1-[2-(2,2-difluoroethoxy)ethyl]piperidin-3-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[1-[2-(2,2-difluoroethoxy)ethyl]piperidin-3-yl]ethanamine |
| PubChem CID | 120967195 |
| Molecular Formula | C11H22F2N2O |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | 2-[1-[2-(2,2-difluoroethoxy)ethyl]piperidin-3-yl]ethanamine |
| SMILES | NCCC1CCCN(CCOCC(F)F)C1 |
| InChI | InChI=1S/C11H22F2N2O/c12-11(13)9-16-7-6-15-5-1-2-10(8-15)3-4-14/h10-11H,1-9,14H2 |
| InChIKey | BTPDSHHSUYENLY-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-[2-(2,2-difluoroethoxy)ethyl]piperidin-3-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[2-(2,2-difluoroethoxy)ethyl]piperidin-3-yl]ethanamine?
The IUPAC name of 2-[1-[2-(2,2-difluoroethoxy)ethyl]piperidin-3-yl]ethanamine (CID 120967195) is 2-[1-[2-(2,2-difluoroethoxy)ethyl]piperidin-3-yl]ethanamine.
What is the SMILES notation for 2-[1-[2-(2,2-difluoroethoxy)ethyl]piperidin-3-yl]ethanamine?
The canonical SMILES for 2-[1-[2-(2,2-difluoroethoxy)ethyl]piperidin-3-yl]ethanamine is NCCC1CCCN(CCOCC(F)F)C1.
What is the InChIKey of 2-[1-[2-(2,2-difluoroethoxy)ethyl]piperidin-3-yl]ethanamine?
The InChIKey is BTPDSHHSUYENLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22F2N2O/c12-11(13)9-16-7-6-15-5-1-2-10(8-15)3-4-14/h10-11H,1-9,14H2.
What are the key properties of 2-[1-[2-(2,2-difluoroethoxy)ethyl]piperidin-3-yl]ethanamine?
2-[1-[2-(2,2-difluoroethoxy)ethyl]piperidin-3-yl]ethanamine has a molecular weight of 236.31 g/mol, XLogP of 1.33, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[2-(2,2-difluoroethoxy)ethyl]piperidin-3-yl]ethanamine is sourced from PubChem (CID 120967195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).