C14H22Cl2N2O — CID 120967311
[1-[(2-chloro-5-methoxyphenyl)methyl]-3-methylpyrrolidin-3-yl]methanamine;hydrochloride (PubChem CID 120967311) has the molecular formula C14H22Cl2N2O and a molecular weight of 305.25 g/mol. Its IUPAC name is [1-[(2-chloro-5-methoxyphenyl)methyl]-3-methylpyrrolidin-3-yl]methanamine;hydrochloride.
| Compound Name | [1-[(2-chloro-5-methoxyphenyl)methyl]-3-methylpyrrolidin-3-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 120967311 |
| Molecular Formula | C14H22Cl2N2O |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | [1-[(2-chloro-5-methoxyphenyl)methyl]-3-methylpyrrolidin-3-yl]methanamine;hydrochloride |
| SMILES | COc1ccc(Cl)c(CN2CCC(C)(CN)C2)c1.Cl |
| InChI | InChI=1S/C14H21ClN2O.ClH/c1-14(9-16)5-6-17(10-14)8-11-7-12(18-2)3-4-13(11)15;/h3-4,7H,5-6,8-10,16H2,1-2H3;1H |
| InChIKey | VSCAIGYWUDIRDQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |