C12H17BrIN3O — CID 120970232
N-[(2-bromo-5-methoxyphenyl)methyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide (PubChem CID 120970232) has the molecular formula C12H17BrIN3O and a molecular weight of 426.10 g/mol. Its IUPAC name is N-[(2-bromo-5-methoxyphenyl)methyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide.
| Compound Name | N-[(2-bromo-5-methoxyphenyl)methyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide |
|---|---|
| PubChem CID | 120970232 |
| Molecular Formula | C12H17BrIN3O |
| Molecular Weight | 426.10 g/mol |
| Exact Mass | 424.96 |
| IUPAC Name | N-[(2-bromo-5-methoxyphenyl)methyl]-1-methyl-4,5-dihydroimidazol-2-amine;hydroiodide |
| SMILES | COc1ccc(Br)c(CNC2=NCCN2C)c1.I |
| InChI | InChI=1S/C12H16BrN3O.HI/c1-16-6-5-14-12(16)15-8-9-7-10(17-2)3-4-11(9)13;/h3-4,7H,5-6,8H2,1-2H3,(H,14,15);1H |
| InChIKey | CXEAFQZGOJVUQO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.10 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|