C15H20N4 — CID 120970551
N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-1-methyl-4,5-dihydroimidazol-2-amine (PubChem CID 120970551) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-1-methyl-4,5-dihydroimidazol-2-amine.
| Compound Name | N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-1-methyl-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 120970551 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-1-methyl-4,5-dihydroimidazol-2-amine |
| SMILES | Cc1[nH]c2ccc(CNC3=NCCN3C)cc2c1C |
| InChI | InChI=1S/C15H20N4/c1-10-11(2)18-14-5-4-12(8-13(10)14)9-17-15-16-6-7-19(15)3/h4-5,8,18H,6-7,9H2,1-3H3,(H,16,17) |
| InChIKey | SXZWTRTVXOZKQA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 43.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|