About N'-(2-methoxyethyl)-N'-methyl-N-(1-methyl-4,5-dihydroimidazol-2-yl)ethane-1,2-diamine;hydroiodide
N'-(2-methoxyethyl)-N'-methyl-N-(1-methyl-4,5-dihydroimidazol-2-yl)ethane-1,2-diamine;hydroiodide (PubChem CID 120970734) has the molecular formula C10H23IN4O
and a molecular weight of 342.23 g/mol. Its IUPAC name is N'-(2-methoxyethyl)-N'-methyl-N-(1-methyl-4,5-dihydroimidazol-2-yl)ethane-1,2-diamine;hydroiodide.
Molecular Properties
| Compound Name | N'-(2-methoxyethyl)-N'-methyl-N-(1-methyl-4,5-dihydroimidazol-2-yl)ethane-1,2-diamine;hydroiodide |
| PubChem CID | 120970734 |
| Molecular Formula | C10H23IN4O |
| Molecular Weight | 342.23 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | N'-(2-methoxyethyl)-N'-methyl-N-(1-methyl-4,5-dihydroimidazol-2-yl)ethane-1,2-diamine;hydroiodide |
| SMILES | COCCN(C)CCNC1=NCCN1C.I |
| InChI | InChI=1S/C10H22N4O.HI/c1-13(8-9-15-3)6-4-11-10-12-5-7-14(10)2;/h4-9H2,1-3H3,(H,11,12);1H |
| InChIKey | ACILIFIEWURMSV-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.23 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-methoxyethyl)-N'-methyl-N-(1-methyl-4,5-dihydroimidazol-2-yl)ethane-1,2-diamine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-methoxyethyl)-N'-methyl-N-(1-methyl-4,5-dihydroimidazol-2-yl)ethane-1,2-diamine;hydroiodide?
The IUPAC name of N'-(2-methoxyethyl)-N'-methyl-N-(1-methyl-4,5-dihydroimidazol-2-yl)ethane-1,2-diamine;hydroiodide (CID 120970734) is N'-(2-methoxyethyl)-N'-methyl-N-(1-methyl-4,5-dihydroimidazol-2-yl)ethane-1,2-diamine;hydroiodide.
What is the SMILES notation for N'-(2-methoxyethyl)-N'-methyl-N-(1-methyl-4,5-dihydroimidazol-2-yl)ethane-1,2-diamine;hydroiodide?
The canonical SMILES for N'-(2-methoxyethyl)-N'-methyl-N-(1-methyl-4,5-dihydroimidazol-2-yl)ethane-1,2-diamine;hydroiodide is COCCN(C)CCNC1=NCCN1C.I.
What is the InChIKey of N'-(2-methoxyethyl)-N'-methyl-N-(1-methyl-4,5-dihydroimidazol-2-yl)ethane-1,2-diamine;hydroiodide?
The InChIKey is ACILIFIEWURMSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N4O.HI/c1-13(8-9-15-3)6-4-11-10-12-5-7-14(10)2;/h4-9H2,1-3H3,(H,11,12);1H.
What are the key properties of N'-(2-methoxyethyl)-N'-methyl-N-(1-methyl-4,5-dihydroimidazol-2-yl)ethane-1,2-diamine;hydroiodide?
N'-(2-methoxyethyl)-N'-methyl-N-(1-methyl-4,5-dihydroimidazol-2-yl)ethane-1,2-diamine;hydroiodide has a molecular weight of 342.23 g/mol, XLogP of 0.07, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-methoxyethyl)-N'-methyl-N-(1-methyl-4,5-dihydroimidazol-2-yl)ethane-1,2-diamine;hydroiodide is sourced from PubChem (CID 120970734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).