About 5-methyl-N-[(5-phenyl-1,3-oxazol-4-yl)methyl]-4,5-dihydro-1H-imidazol-2-amine
5-methyl-N-[(5-phenyl-1,3-oxazol-4-yl)methyl]-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 120971665) has the molecular formula C14H16N4O
and a molecular weight of 256.31 g/mol. Its IUPAC name is 5-methyl-N-[(5-phenyl-1,3-oxazol-4-yl)methyl]-4,5-dihydro-1H-imidazol-2-amine.
Molecular Properties
| Compound Name | 5-methyl-N-[(5-phenyl-1,3-oxazol-4-yl)methyl]-4,5-dihydro-1H-imidazol-2-amine |
| PubChem CID | 120971665 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 5-methyl-N-[(5-phenyl-1,3-oxazol-4-yl)methyl]-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | CC1CN=C(NCc2ncoc2-c2ccccc2)N1 |
| InChI | InChI=1S/C14H16N4O/c1-10-7-15-14(18-10)16-8-12-13(19-9-17-12)11-5-3-2-4-6-11/h2-6,9-10H,7-8H2,1H3,(H2,15,16,18) |
| InChIKey | DYWQRNYUPILKRR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methyl-N-[(5-phenyl-1,3-oxazol-4-yl)methyl]-4,5-dihydro-1H-imidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N-[(5-phenyl-1,3-oxazol-4-yl)methyl]-4,5-dihydro-1H-imidazol-2-amine?
The IUPAC name of 5-methyl-N-[(5-phenyl-1,3-oxazol-4-yl)methyl]-4,5-dihydro-1H-imidazol-2-amine (CID 120971665) is 5-methyl-N-[(5-phenyl-1,3-oxazol-4-yl)methyl]-4,5-dihydro-1H-imidazol-2-amine.
What is the SMILES notation for 5-methyl-N-[(5-phenyl-1,3-oxazol-4-yl)methyl]-4,5-dihydro-1H-imidazol-2-amine?
The canonical SMILES for 5-methyl-N-[(5-phenyl-1,3-oxazol-4-yl)methyl]-4,5-dihydro-1H-imidazol-2-amine is CC1CN=C(NCc2ncoc2-c2ccccc2)N1.
What is the InChIKey of 5-methyl-N-[(5-phenyl-1,3-oxazol-4-yl)methyl]-4,5-dihydro-1H-imidazol-2-amine?
The InChIKey is DYWQRNYUPILKRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4O/c1-10-7-15-14(18-10)16-8-12-13(19-9-17-12)11-5-3-2-4-6-11/h2-6,9-10H,7-8H2,1H3,(H2,15,16,18).
What are the key properties of 5-methyl-N-[(5-phenyl-1,3-oxazol-4-yl)methyl]-4,5-dihydro-1H-imidazol-2-amine?
5-methyl-N-[(5-phenyl-1,3-oxazol-4-yl)methyl]-4,5-dihydro-1H-imidazol-2-amine has a molecular weight of 256.31 g/mol, XLogP of 1.78, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N-[(5-phenyl-1,3-oxazol-4-yl)methyl]-4,5-dihydro-1H-imidazol-2-amine is sourced from PubChem (CID 120971665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).