About 1-methyl-N-[(5-phenyl-1,3-oxazol-4-yl)methyl]-4,5-dihydroimidazol-2-amine;hydroiodide
1-methyl-N-[(5-phenyl-1,3-oxazol-4-yl)methyl]-4,5-dihydroimidazol-2-amine;hydroiodide (PubChem CID 120971666) has the molecular formula C14H17IN4O
and a molecular weight of 384.22 g/mol. Its IUPAC name is 1-methyl-N-[(5-phenyl-1,3-oxazol-4-yl)methyl]-4,5-dihydroimidazol-2-amine;hydroiodide.
Molecular Properties
| Compound Name | 1-methyl-N-[(5-phenyl-1,3-oxazol-4-yl)methyl]-4,5-dihydroimidazol-2-amine;hydroiodide |
| PubChem CID | 120971666 |
| Molecular Formula | C14H17IN4O |
| Molecular Weight | 384.22 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 1-methyl-N-[(5-phenyl-1,3-oxazol-4-yl)methyl]-4,5-dihydroimidazol-2-amine;hydroiodide |
| SMILES | CN1CCN=C1NCc1ncoc1-c1ccccc1.I |
| InChI | InChI=1S/C14H16N4O.HI/c1-18-8-7-15-14(18)16-9-12-13(19-10-17-12)11-5-3-2-4-6-11;/h2-6,10H,7-9H2,1H3,(H,15,16);1H |
| InChIKey | OJNCEZQGXSJGDU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.22 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-N-[(5-phenyl-1,3-oxazol-4-yl)methyl]-4,5-dihydroimidazol-2-amine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-N-[(5-phenyl-1,3-oxazol-4-yl)methyl]-4,5-dihydroimidazol-2-amine;hydroiodide?
The IUPAC name of 1-methyl-N-[(5-phenyl-1,3-oxazol-4-yl)methyl]-4,5-dihydroimidazol-2-amine;hydroiodide (CID 120971666) is 1-methyl-N-[(5-phenyl-1,3-oxazol-4-yl)methyl]-4,5-dihydroimidazol-2-amine;hydroiodide.
What is the SMILES notation for 1-methyl-N-[(5-phenyl-1,3-oxazol-4-yl)methyl]-4,5-dihydroimidazol-2-amine;hydroiodide?
The canonical SMILES for 1-methyl-N-[(5-phenyl-1,3-oxazol-4-yl)methyl]-4,5-dihydroimidazol-2-amine;hydroiodide is CN1CCN=C1NCc1ncoc1-c1ccccc1.I.
What is the InChIKey of 1-methyl-N-[(5-phenyl-1,3-oxazol-4-yl)methyl]-4,5-dihydroimidazol-2-amine;hydroiodide?
The InChIKey is OJNCEZQGXSJGDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4O.HI/c1-18-8-7-15-14(18)16-9-12-13(19-10-17-12)11-5-3-2-4-6-11;/h2-6,10H,7-9H2,1H3,(H,15,16);1H.
What are the key properties of 1-methyl-N-[(5-phenyl-1,3-oxazol-4-yl)methyl]-4,5-dihydroimidazol-2-amine;hydroiodide?
1-methyl-N-[(5-phenyl-1,3-oxazol-4-yl)methyl]-4,5-dihydroimidazol-2-amine;hydroiodide has a molecular weight of 384.22 g/mol, XLogP of 2.35, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-N-[(5-phenyl-1,3-oxazol-4-yl)methyl]-4,5-dihydroimidazol-2-amine;hydroiodide is sourced from PubChem (CID 120971666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).