About [4-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]oxan-4-yl]methanol;hydroiodide
[4-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]oxan-4-yl]methanol;hydroiodide (PubChem CID 120971770) has the molecular formula C11H22IN3O2
and a molecular weight of 355.22 g/mol. Its IUPAC name is [4-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]oxan-4-yl]methanol;hydroiodide.
Molecular Properties
| Compound Name | [4-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]oxan-4-yl]methanol;hydroiodide |
| PubChem CID | 120971770 |
| Molecular Formula | C11H22IN3O2 |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | [4-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]oxan-4-yl]methanol;hydroiodide |
| SMILES | CC1CN=C(NCC2(CO)CCOCC2)N1.I |
| InChI | InChI=1S/C11H21N3O2.HI/c1-9-6-12-10(14-9)13-7-11(8-15)2-4-16-5-3-11;/h9,15H,2-8H2,1H3,(H2,12,13,14);1H |
| InChIKey | SXFKMRBWHZIBHN-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [4-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]oxan-4-yl]methanol;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]oxan-4-yl]methanol;hydroiodide?
The IUPAC name of [4-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]oxan-4-yl]methanol;hydroiodide (CID 120971770) is [4-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]oxan-4-yl]methanol;hydroiodide.
What is the SMILES notation for [4-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]oxan-4-yl]methanol;hydroiodide?
The canonical SMILES for [4-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]oxan-4-yl]methanol;hydroiodide is CC1CN=C(NCC2(CO)CCOCC2)N1.I.
What is the InChIKey of [4-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]oxan-4-yl]methanol;hydroiodide?
The InChIKey is SXFKMRBWHZIBHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3O2.HI/c1-9-6-12-10(14-9)13-7-11(8-15)2-4-16-5-3-11;/h9,15H,2-8H2,1H3,(H2,12,13,14);1H.
What are the key properties of [4-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]oxan-4-yl]methanol;hydroiodide?
[4-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]oxan-4-yl]methanol;hydroiodide has a molecular weight of 355.22 g/mol, XLogP of 0.33, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[(5-methyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]oxan-4-yl]methanol;hydroiodide is sourced from PubChem (CID 120971770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).